C21H19N3O3S — CID 23962291
3-[(2,3-dimethoxyphenyl)methylamino]-2-thiophen-2-ylquinazolin-4-one (PubChem CID 23962291) has the molecular formula C21H19N3O3S and a molecular weight of 393.47 g/mol. Its IUPAC name is 3-[(2,3-dimethoxyphenyl)methylamino]-2-thiophen-2-ylquinazolin-4-one.
| Compound Name | 3-[(2,3-dimethoxyphenyl)methylamino]-2-thiophen-2-ylquinazolin-4-one |
|---|---|
| PubChem CID | 23962291 |
| Molecular Formula | C21H19N3O3S |
| Molecular Weight | 393.47 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | 3-[(2,3-dimethoxyphenyl)methylamino]-2-thiophen-2-ylquinazolin-4-one |
| SMILES | COc1cccc(CNn2c(-c3cccs3)nc3ccccc3c2=O)c1OC |
| InChI | InChI=1S/C21H19N3O3S/c1-26-17-10-5-7-14(19(17)27-2)13-22-24-20(18-11-6-12-28-18)23-16-9-4-3-8-15(16)21(24)25/h3-12,22H,13H2,1-2H3 |
| InChIKey | WTSDXTJRDSOMAE-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.47 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |