C26H27N3O5 — CID 23761607
3-[(2-ethoxyphenyl)methylamino]-2-(3,4,5-trimethoxyphenyl)quinazolin-4-one (PubChem CID 23761607) has the molecular formula C26H27N3O5 and a molecular weight of 461.52 g/mol. Its IUPAC name is 3-[(2-ethoxyphenyl)methylamino]-2-(3,4,5-trimethoxyphenyl)quinazolin-4-one.
| Compound Name | 3-[(2-ethoxyphenyl)methylamino]-2-(3,4,5-trimethoxyphenyl)quinazolin-4-one |
|---|---|
| PubChem CID | 23761607 |
| Molecular Formula | C26H27N3O5 |
| Molecular Weight | 461.52 g/mol |
| Exact Mass | 461.20 |
| IUPAC Name | 3-[(2-ethoxyphenyl)methylamino]-2-(3,4,5-trimethoxyphenyl)quinazolin-4-one |
| SMILES | CCOc1ccccc1CNn1c(-c2cc(OC)c(OC)c(OC)c2)nc2ccccc2c1=O |
| InChI | InChI=1S/C26H27N3O5/c1-5-34-21-13-9-6-10-17(21)16-27-29-25(28-20-12-8-7-11-19(20)26(29)30)18-14-22(31-2)24(33-4)23(15-18)32-3/h6-15,27H,5,16H2,1-4H3 |
| InChIKey | NVXXFICLWVGISZ-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 83.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.52 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |