C29H32N2O3 — CID 2024284
3-[6-(3,4-dimethylphenoxy)hexyl]-2-(4-methoxyphenyl)quinazolin-4-one (PubChem CID 2024284) has the molecular formula C29H32N2O3 and a molecular weight of 456.59 g/mol. Its IUPAC name is 3-[6-(3,4-dimethylphenoxy)hexyl]-2-(4-methoxyphenyl)quinazolin-4-one.
| Compound Name | 3-[6-(3,4-dimethylphenoxy)hexyl]-2-(4-methoxyphenyl)quinazolin-4-one |
|---|---|
| PubChem CID | 2024284 |
| Molecular Formula | C29H32N2O3 |
| Molecular Weight | 456.59 g/mol |
| Exact Mass | 456.24 |
| IUPAC Name | 3-[6-(3,4-dimethylphenoxy)hexyl]-2-(4-methoxyphenyl)quinazolin-4-one |
| SMILES | COc1ccc(-c2nc3ccccc3c(=O)n2CCCCCCOc2ccc(C)c(C)c2)cc1 |
| InChI | InChI=1S/C29H32N2O3/c1-21-12-15-25(20-22(21)2)34-19-9-5-4-8-18-31-28(23-13-16-24(33-3)17-14-23)30-27-11-7-6-10-26(27)29(31)32/h6-7,10-17,20H,4-5,8-9,18-19H2,1-3H3 |
| InChIKey | SKBHVYBBPPVPMW-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.59 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|