About 3-[2-[2,6-di(propan-2-yl)phenoxy]ethyl]-2-(4-methoxyphenyl)quinazolin-4-one
3-[2-[2,6-di(propan-2-yl)phenoxy]ethyl]-2-(4-methoxyphenyl)quinazolin-4-one (PubChem CID 2004073) has the molecular formula C29H32N2O3
and a molecular weight of 456.59 g/mol. Its IUPAC name is 3-[2-[2,6-di(propan-2-yl)phenoxy]ethyl]-2-(4-methoxyphenyl)quinazolin-4-one.
Molecular Properties
| Compound Name | 3-[2-[2,6-di(propan-2-yl)phenoxy]ethyl]-2-(4-methoxyphenyl)quinazolin-4-one |
| PubChem CID | 2004073 |
| Molecular Formula | C29H32N2O3 |
| Molecular Weight | 456.59 g/mol |
| Exact Mass | 456.24 |
| IUPAC Name | 3-[2-[2,6-di(propan-2-yl)phenoxy]ethyl]-2-(4-methoxyphenyl)quinazolin-4-one |
| SMILES | COc1ccc(-c2nc3ccccc3c(=O)n2CCOc2c(C(C)C)cccc2C(C)C)cc1 |
| InChI | InChI=1S/C29H32N2O3/c1-19(2)23-10-8-11-24(20(3)4)27(23)34-18-17-31-28(21-13-15-22(33-5)16-14-21)30-26-12-7-6-9-25(26)29(31)32/h6-16,19-20H,17-18H2,1-5H3 |
| InChIKey | KNFMVEIDEYLBKH-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 456.59 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[2-[2,6-di(propan-2-yl)phenoxy]ethyl]-2-(4-methoxyphenyl)quinazolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-[2,6-di(propan-2-yl)phenoxy]ethyl]-2-(4-methoxyphenyl)quinazolin-4-one?
The IUPAC name of 3-[2-[2,6-di(propan-2-yl)phenoxy]ethyl]-2-(4-methoxyphenyl)quinazolin-4-one (CID 2004073) is 3-[2-[2,6-di(propan-2-yl)phenoxy]ethyl]-2-(4-methoxyphenyl)quinazolin-4-one.
What is the SMILES notation for 3-[2-[2,6-di(propan-2-yl)phenoxy]ethyl]-2-(4-methoxyphenyl)quinazolin-4-one?
The canonical SMILES for 3-[2-[2,6-di(propan-2-yl)phenoxy]ethyl]-2-(4-methoxyphenyl)quinazolin-4-one is COc1ccc(-c2nc3ccccc3c(=O)n2CCOc2c(C(C)C)cccc2C(C)C)cc1.
What is the InChIKey of 3-[2-[2,6-di(propan-2-yl)phenoxy]ethyl]-2-(4-methoxyphenyl)quinazolin-4-one?
The InChIKey is KNFMVEIDEYLBKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H32N2O3/c1-19(2)23-10-8-11-24(20(3)4)27(23)34-18-17-31-28(21-13-15-22(33-5)16-14-21)30-26-12-7-6-9-25(26)29(31)32/h6-16,19-20H,17-18H2,1-5H3.
What are the key properties of 3-[2-[2,6-di(propan-2-yl)phenoxy]ethyl]-2-(4-methoxyphenyl)quinazolin-4-one?
3-[2-[2,6-di(propan-2-yl)phenoxy]ethyl]-2-(4-methoxyphenyl)quinazolin-4-one has a molecular weight of 456.59 g/mol, XLogP of 6.40, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-[2,6-di(propan-2-yl)phenoxy]ethyl]-2-(4-methoxyphenyl)quinazolin-4-one is sourced from PubChem (CID 2004073), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).