C25H24N2O5 — CID 3534114
3-[2-(2,6-dimethoxyphenoxy)ethyl]-2-(4-methoxyphenyl)quinazolin-4-one (PubChem CID 3534114) has the molecular formula C25H24N2O5 and a molecular weight of 432.48 g/mol. Its IUPAC name is 3-[2-(2,6-dimethoxyphenoxy)ethyl]-2-(4-methoxyphenyl)quinazolin-4-one.
| Compound Name | 3-[2-(2,6-dimethoxyphenoxy)ethyl]-2-(4-methoxyphenyl)quinazolin-4-one |
|---|---|
| PubChem CID | 3534114 |
| Molecular Formula | C25H24N2O5 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | 3-[2-(2,6-dimethoxyphenoxy)ethyl]-2-(4-methoxyphenyl)quinazolin-4-one |
| SMILES | COc1ccc(-c2nc3ccccc3c(=O)n2CCOc2c(OC)cccc2OC)cc1 |
| InChI | InChI=1S/C25H24N2O5/c1-29-18-13-11-17(12-14-18)24-26-20-8-5-4-7-19(20)25(28)27(24)15-16-32-23-21(30-2)9-6-10-22(23)31-3/h4-14H,15-16H2,1-3H3 |
| InChIKey | LDZLEFLUVJVXDM-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 71.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |