C27H28N2O4 — CID 2014020
3-[2-[2-(2,6-dimethylphenoxy)ethoxy]ethyl]-2-(4-methoxyphenyl)quinazolin-4-one (PubChem CID 2014020) has the molecular formula C27H28N2O4 and a molecular weight of 444.53 g/mol. Its IUPAC name is 3-[2-[2-(2,6-dimethylphenoxy)ethoxy]ethyl]-2-(4-methoxyphenyl)quinazolin-4-one.
| Compound Name | 3-[2-[2-(2,6-dimethylphenoxy)ethoxy]ethyl]-2-(4-methoxyphenyl)quinazolin-4-one |
|---|---|
| PubChem CID | 2014020 |
| Molecular Formula | C27H28N2O4 |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | 3-[2-[2-(2,6-dimethylphenoxy)ethoxy]ethyl]-2-(4-methoxyphenyl)quinazolin-4-one |
| SMILES | COc1ccc(-c2nc3ccccc3c(=O)n2CCOCCOc2c(C)cccc2C)cc1 |
| InChI | InChI=1S/C27H28N2O4/c1-19-7-6-8-20(2)25(19)33-18-17-32-16-15-29-26(21-11-13-22(31-3)14-12-21)28-24-10-5-4-9-23(24)27(29)30/h4-14H,15-18H2,1-3H3 |
| InChIKey | XTGCJBQCRKAMNN-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 62.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|