C16H23NO4 — CID 66206737
ethyl 3-(4-tert-butylphenyl)-2-formamido-3-hydroxypropanoate (PubChem CID 66206737) has the molecular formula C16H23NO4 and a molecular weight of 293.36 g/mol. Its IUPAC name is ethyl 3-(4-tert-butylphenyl)-2-formamido-3-hydroxypropanoate.
| Compound Name | ethyl 3-(4-tert-butylphenyl)-2-formamido-3-hydroxypropanoate |
|---|---|
| PubChem CID | 66206737 |
| Molecular Formula | C16H23NO4 |
| Molecular Weight | 293.36 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | ethyl 3-(4-tert-butylphenyl)-2-formamido-3-hydroxypropanoate |
| SMILES | CCOC(=O)C(NC=O)C(O)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C16H23NO4/c1-5-21-15(20)13(17-10-18)14(19)11-6-8-12(9-7-11)16(2,3)4/h6-10,13-14,19H,5H2,1-4H3,(H,17,18) |
| InChIKey | ZICPEBRSEQXDRW-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.36 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|