C14H21N3O2S — CID 66207623
2-(4-ethyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)benzenesulfonamide (PubChem CID 66207623) has the molecular formula C14H21N3O2S and a molecular weight of 295.41 g/mol. Its IUPAC name is 2-(4-ethyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)benzenesulfonamide.
| Compound Name | 2-(4-ethyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 66207623 |
| Molecular Formula | C14H21N3O2S |
| Molecular Weight | 295.41 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | 2-(4-ethyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)benzenesulfonamide |
| SMILES | CCC1C2CNCC2CN1c1ccccc1S(N)(=O)=O |
| InChI | InChI=1S/C14H21N3O2S/c1-2-12-11-8-16-7-10(11)9-17(12)13-5-3-4-6-14(13)20(15,18)19/h3-6,10-12,16H,2,7-9H2,1H3,(H2,15,18,19) |
| InChIKey | IDQNPOIDGVZWHD-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.41 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |