C17H20N2O2 — CID 66207735
1-benzofuran-3-yl-(4-ethyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)methanone (PubChem CID 66207735) has the molecular formula C17H20N2O2 and a molecular weight of 284.36 g/mol. Its IUPAC name is 1-benzofuran-3-yl-(4-ethyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)methanone.
| Compound Name | 1-benzofuran-3-yl-(4-ethyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)methanone |
|---|---|
| PubChem CID | 66207735 |
| Molecular Formula | C17H20N2O2 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | 1-benzofuran-3-yl-(4-ethyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)methanone |
| SMILES | CCC1C2CNCC2CN1C(=O)c1coc2ccccc12 |
| InChI | InChI=1S/C17H20N2O2/c1-2-15-13-8-18-7-11(13)9-19(15)17(20)14-10-21-16-6-4-3-5-12(14)16/h3-6,10-11,13,15,18H,2,7-9H2,1H3 |
| InChIKey | YOHFYQDAJUMOHM-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |