C15H20Cl2N2S — CID 66207872
5-[2-(2,5-dichlorophenyl)sulfanylethyl]-4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole (PubChem CID 66207872) has the molecular formula C15H20Cl2N2S and a molecular weight of 331.31 g/mol. Its IUPAC name is 5-[2-(2,5-dichlorophenyl)sulfanylethyl]-4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole.
| Compound Name | 5-[2-(2,5-dichlorophenyl)sulfanylethyl]-4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole |
|---|---|
| PubChem CID | 66207872 |
| Molecular Formula | C15H20Cl2N2S |
| Molecular Weight | 331.31 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | 5-[2-(2,5-dichlorophenyl)sulfanylethyl]-4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole |
| SMILES | CC1C2CNCC2CN1CCSc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C15H20Cl2N2S/c1-10-13-8-18-7-11(13)9-19(10)4-5-20-15-6-12(16)2-3-14(15)17/h2-3,6,10-11,13,18H,4-5,7-9H2,1H3 |
| InChIKey | GSPAVTBOVGYXLP-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.31 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |