C16H24N2S — CID 66208678
4-ethyl-5-(4,5,6,7-tetrahydro-1-benzothiophen-4-yl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole (PubChem CID 66208678) has the molecular formula C16H24N2S and a molecular weight of 276.45 g/mol. Its IUPAC name is 4-ethyl-5-(4,5,6,7-tetrahydro-1-benzothiophen-4-yl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole.
| Compound Name | 4-ethyl-5-(4,5,6,7-tetrahydro-1-benzothiophen-4-yl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole |
|---|---|
| PubChem CID | 66208678 |
| Molecular Formula | C16H24N2S |
| Molecular Weight | 276.45 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | 4-ethyl-5-(4,5,6,7-tetrahydro-1-benzothiophen-4-yl)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole |
| SMILES | CCC1C2CNCC2CN1C1CCCc2sccc21 |
| InChI | InChI=1S/C16H24N2S/c1-2-14-13-9-17-8-11(13)10-18(14)15-4-3-5-16-12(15)6-7-19-16/h6-7,11,13-15,17H,2-5,8-10H2,1H3 |
| InChIKey | ISPKMVAZJPUDPR-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.45 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |