C15H18F2N2O2 — CID 66208795
[2-(difluoromethoxy)phenyl]-(4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)methanone (PubChem CID 66208795) has the molecular formula C15H18F2N2O2 and a molecular weight of 296.32 g/mol. Its IUPAC name is [2-(difluoromethoxy)phenyl]-(4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)methanone.
| Compound Name | [2-(difluoromethoxy)phenyl]-(4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)methanone |
|---|---|
| PubChem CID | 66208795 |
| Molecular Formula | C15H18F2N2O2 |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | [2-(difluoromethoxy)phenyl]-(4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)methanone |
| SMILES | CC1C2CNCC2CN1C(=O)c1ccccc1OC(F)F |
| InChI | InChI=1S/C15H18F2N2O2/c1-9-12-7-18-6-10(12)8-19(9)14(20)11-4-2-3-5-13(11)21-15(16)17/h2-5,9-10,12,15,18H,6-8H2,1H3 |
| InChIKey | DGUJRSIDONGIGA-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |