C15H12FN3S3 — CID 6620945
7-[(4-fluorophenyl)methylsulfanyl]-3-prop-2-enyl-[1,3]thiazolo[4,5-d]pyrimidine-2-thione (PubChem CID 6620945) has the molecular formula C15H12FN3S3 and a molecular weight of 349.48 g/mol. Its IUPAC name is 7-[(4-fluorophenyl)methylsulfanyl]-3-prop-2-enyl-[1,3]thiazolo[4,5-d]pyrimidine-2-thione.
| Compound Name | 7-[(4-fluorophenyl)methylsulfanyl]-3-prop-2-enyl-[1,3]thiazolo[4,5-d]pyrimidine-2-thione |
|---|---|
| PubChem CID | 6620945 |
| Molecular Formula | C15H12FN3S3 |
| Molecular Weight | 349.48 g/mol |
| Exact Mass | 349.02 |
| IUPAC Name | 7-[(4-fluorophenyl)methylsulfanyl]-3-prop-2-enyl-[1,3]thiazolo[4,5-d]pyrimidine-2-thione |
| SMILES | C=CCn1c(=S)sc2c(SCc3ccc(F)cc3)ncnc21 |
| InChI | InChI=1S/C15H12FN3S3/c1-2-7-19-13-12(22-15(19)20)14(18-9-17-13)21-8-10-3-5-11(16)6-4-10/h2-6,9H,1,7-8H2 |
| InChIKey | DZVAPNINLGUMPG-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.48 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|