C16H22FN3O — CID 66209798
N-(5-fluoro-2-methylphenyl)-2-(4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)acetamide (PubChem CID 66209798) has the molecular formula C16H22FN3O and a molecular weight of 291.37 g/mol. Its IUPAC name is N-(5-fluoro-2-methylphenyl)-2-(4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)acetamide.
| Compound Name | N-(5-fluoro-2-methylphenyl)-2-(4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)acetamide |
|---|---|
| PubChem CID | 66209798 |
| Molecular Formula | C16H22FN3O |
| Molecular Weight | 291.37 g/mol |
| Exact Mass | 291.17 |
| IUPAC Name | N-(5-fluoro-2-methylphenyl)-2-(4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)acetamide |
| SMILES | Cc1ccc(F)cc1NC(=O)CN1CC2CNCC2C1C |
| InChI | InChI=1S/C16H22FN3O/c1-10-3-4-13(17)5-15(10)19-16(21)9-20-8-12-6-18-7-14(12)11(20)2/h3-5,11-12,14,18H,6-9H2,1-2H3,(H,19,21) |
| InChIKey | OLJVFYSFERRCMP-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.37 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |