C13H21N3S — CID 66210037
5-[(4-ethyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)methyl]-4-methyl-1,3-thiazole (PubChem CID 66210037) has the molecular formula C13H21N3S and a molecular weight of 251.40 g/mol. Its IUPAC name is 5-[(4-ethyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)methyl]-4-methyl-1,3-thiazole.
| Compound Name | 5-[(4-ethyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)methyl]-4-methyl-1,3-thiazole |
|---|---|
| PubChem CID | 66210037 |
| Molecular Formula | C13H21N3S |
| Molecular Weight | 251.40 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | 5-[(4-ethyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)methyl]-4-methyl-1,3-thiazole |
| SMILES | CCC1C2CNCC2CN1Cc1scnc1C |
| InChI | InChI=1S/C13H21N3S/c1-3-12-11-5-14-4-10(11)6-16(12)7-13-9(2)15-8-17-13/h8,10-12,14H,3-7H2,1-2H3 |
| InChIKey | XNSTZKFBPHSXBJ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.40 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |