C16H22N2O — CID 66212239
5-(2,3-dihydro-1-benzofuran-5-ylmethyl)-4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole (PubChem CID 66212239) has the molecular formula C16H22N2O and a molecular weight of 258.37 g/mol. Its IUPAC name is 5-(2,3-dihydro-1-benzofuran-5-ylmethyl)-4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole.
| Compound Name | 5-(2,3-dihydro-1-benzofuran-5-ylmethyl)-4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole |
|---|---|
| PubChem CID | 66212239 |
| Molecular Formula | C16H22N2O |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | 5-(2,3-dihydro-1-benzofuran-5-ylmethyl)-4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole |
| SMILES | CC1C2CNCC2CN1Cc1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C16H22N2O/c1-11-15-8-17-7-14(15)10-18(11)9-12-2-3-16-13(6-12)4-5-19-16/h2-3,6,11,14-15,17H,4-5,7-10H2,1H3 |
| InChIKey | BAAVJNDFCNMWAB-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |