About 5-propan-2-yl-N-propyl-1,2-oxazole-3-carboxamide
5-propan-2-yl-N-propyl-1,2-oxazole-3-carboxamide (PubChem CID 6621383) has the molecular formula C10H16N2O2
and a molecular weight of 196.25 g/mol. Its IUPAC name is 5-propan-2-yl-N-propyl-1,2-oxazole-3-carboxamide.
Molecular Properties
| Compound Name | 5-propan-2-yl-N-propyl-1,2-oxazole-3-carboxamide |
| PubChem CID | 6621383 |
| Molecular Formula | C10H16N2O2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.12 |
| IUPAC Name | 5-propan-2-yl-N-propyl-1,2-oxazole-3-carboxamide |
| SMILES | CCCNC(=O)c1cc(C(C)C)on1 |
| InChI | InChI=1S/C10H16N2O2/c1-4-5-11-10(13)8-6-9(7(2)3)14-12-8/h6-7H,4-5H2,1-3H3,(H,11,13) |
| InChIKey | QFYNSGPNRRGXBX-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-propan-2-yl-N-propyl-1,2-oxazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-propan-2-yl-N-propyl-1,2-oxazole-3-carboxamide?
The IUPAC name of 5-propan-2-yl-N-propyl-1,2-oxazole-3-carboxamide (CID 6621383) is 5-propan-2-yl-N-propyl-1,2-oxazole-3-carboxamide.
What is the SMILES notation for 5-propan-2-yl-N-propyl-1,2-oxazole-3-carboxamide?
The canonical SMILES for 5-propan-2-yl-N-propyl-1,2-oxazole-3-carboxamide is CCCNC(=O)c1cc(C(C)C)on1.
What is the InChIKey of 5-propan-2-yl-N-propyl-1,2-oxazole-3-carboxamide?
The InChIKey is QFYNSGPNRRGXBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2O2/c1-4-5-11-10(13)8-6-9(7(2)3)14-12-8/h6-7H,4-5H2,1-3H3,(H,11,13).
What are the key properties of 5-propan-2-yl-N-propyl-1,2-oxazole-3-carboxamide?
5-propan-2-yl-N-propyl-1,2-oxazole-3-carboxamide has a molecular weight of 196.25 g/mol, XLogP of 1.94, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-propan-2-yl-N-propyl-1,2-oxazole-3-carboxamide is sourced from PubChem (CID 6621383), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).