C23H17N3O2 — CID 6621408
2-[(3-benzyl-2,4-dioxoquinazolin-1-yl)methyl]benzonitrile (PubChem CID 6621408) has the molecular formula C23H17N3O2 and a molecular weight of 367.41 g/mol. Its IUPAC name is 2-[(3-benzyl-2,4-dioxoquinazolin-1-yl)methyl]benzonitrile.
| Compound Name | 2-[(3-benzyl-2,4-dioxoquinazolin-1-yl)methyl]benzonitrile |
|---|---|
| PubChem CID | 6621408 |
| Molecular Formula | C23H17N3O2 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.13 |
| IUPAC Name | 2-[(3-benzyl-2,4-dioxoquinazolin-1-yl)methyl]benzonitrile |
| SMILES | N#Cc1ccccc1Cn1c(=O)n(Cc2ccccc2)c(=O)c2ccccc21 |
| InChI | InChI=1S/C23H17N3O2/c24-14-18-10-4-5-11-19(18)16-25-21-13-7-6-12-20(21)22(27)26(23(25)28)15-17-8-2-1-3-9-17/h1-13H,15-16H2 |
| InChIKey | QGSFOSBRJIKAKL-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 67.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |