C13H16FN5O — CID 66214830
N-(5-fluoro-2-methylphenyl)-2-[4-(methylaminomethyl)triazol-1-yl]acetamide (PubChem CID 66214830) has the molecular formula C13H16FN5O and a molecular weight of 277.30 g/mol. Its IUPAC name is N-(5-fluoro-2-methylphenyl)-2-[4-(methylaminomethyl)triazol-1-yl]acetamide.
| Compound Name | N-(5-fluoro-2-methylphenyl)-2-[4-(methylaminomethyl)triazol-1-yl]acetamide |
|---|---|
| PubChem CID | 66214830 |
| Molecular Formula | C13H16FN5O |
| Molecular Weight | 277.30 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | N-(5-fluoro-2-methylphenyl)-2-[4-(methylaminomethyl)triazol-1-yl]acetamide |
| SMILES | CNCc1cn(CC(=O)Nc2cc(F)ccc2C)nn1 |
| InChI | InChI=1S/C13H16FN5O/c1-9-3-4-10(14)5-12(9)16-13(20)8-19-7-11(6-15-2)17-18-19/h3-5,7,15H,6,8H2,1-2H3,(H,16,20) |
| InChIKey | OAGRIKRDMPUNFV-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.30 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |