C14H21ClN2O — CID 66214909
N-[2-(2-chlorophenoxy)ethyl]-N-propylazetidin-3-amine (PubChem CID 66214909) has the molecular formula C14H21ClN2O and a molecular weight of 268.79 g/mol. Its IUPAC name is N-[2-(2-chlorophenoxy)ethyl]-N-propylazetidin-3-amine.
| Compound Name | N-[2-(2-chlorophenoxy)ethyl]-N-propylazetidin-3-amine |
|---|---|
| PubChem CID | 66214909 |
| Molecular Formula | C14H21ClN2O |
| Molecular Weight | 268.79 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | N-[2-(2-chlorophenoxy)ethyl]-N-propylazetidin-3-amine |
| SMILES | CCCN(CCOc1ccccc1Cl)C1CNC1 |
| InChI | InChI=1S/C14H21ClN2O/c1-2-7-17(12-10-16-11-12)8-9-18-14-6-4-3-5-13(14)15/h3-6,12,16H,2,7-11H2,1H3 |
| InChIKey | LDNSTPDJLVOGCP-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.79 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |