C14H21FN2O — CID 66215915
N-[2-(2-fluorophenoxy)ethyl]-N-propylazetidin-3-amine (PubChem CID 66215915) has the molecular formula C14H21FN2O and a molecular weight of 252.33 g/mol. Its IUPAC name is N-[2-(2-fluorophenoxy)ethyl]-N-propylazetidin-3-amine.
| Compound Name | N-[2-(2-fluorophenoxy)ethyl]-N-propylazetidin-3-amine |
|---|---|
| PubChem CID | 66215915 |
| Molecular Formula | C14H21FN2O |
| Molecular Weight | 252.33 g/mol |
| Exact Mass | 252.16 |
| IUPAC Name | N-[2-(2-fluorophenoxy)ethyl]-N-propylazetidin-3-amine |
| SMILES | CCCN(CCOc1ccccc1F)C1CNC1 |
| InChI | InChI=1S/C14H21FN2O/c1-2-7-17(12-10-16-11-12)8-9-18-14-6-4-3-5-13(14)15/h3-6,12,16H,2,7-11H2,1H3 |
| InChIKey | ZLDIKWUZYWZNDD-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.33 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |