C13H21N5O3 — CID 66216564
5-[[4-(diethoxymethyl)triazol-1-yl]methyl]-3-propyl-1,2,4-oxadiazole (PubChem CID 66216564) has the molecular formula C13H21N5O3 and a molecular weight of 295.34 g/mol. Its IUPAC name is 5-[[4-(diethoxymethyl)triazol-1-yl]methyl]-3-propyl-1,2,4-oxadiazole.
| Compound Name | 5-[[4-(diethoxymethyl)triazol-1-yl]methyl]-3-propyl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 66216564 |
| Molecular Formula | C13H21N5O3 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | 5-[[4-(diethoxymethyl)triazol-1-yl]methyl]-3-propyl-1,2,4-oxadiazole |
| SMILES | CCCc1noc(Cn2cc(C(OCC)OCC)nn2)n1 |
| InChI | InChI=1S/C13H21N5O3/c1-4-7-11-14-12(21-16-11)9-18-8-10(15-17-18)13(19-5-2)20-6-3/h8,13H,4-7,9H2,1-3H3 |
| InChIKey | UTQLESJCXFKBQB-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 88.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|