C9H12ClN5O — CID 81449381
3-[[4-(1-chloroethyl)triazol-1-yl]methyl]-5-ethyl-1,2,4-oxadiazole (PubChem CID 81449381) has the molecular formula C9H12ClN5O and a molecular weight of 241.68 g/mol. Its IUPAC name is 3-[[4-(1-chloroethyl)triazol-1-yl]methyl]-5-ethyl-1,2,4-oxadiazole.
| Compound Name | 3-[[4-(1-chloroethyl)triazol-1-yl]methyl]-5-ethyl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 81449381 |
| Molecular Formula | C9H12ClN5O |
| Molecular Weight | 241.68 g/mol |
| Exact Mass | 241.07 |
| IUPAC Name | 3-[[4-(1-chloroethyl)triazol-1-yl]methyl]-5-ethyl-1,2,4-oxadiazole |
| SMILES | CCc1nc(Cn2cc(C(C)Cl)nn2)no1 |
| InChI | InChI=1S/C9H12ClN5O/c1-3-9-11-8(13-16-9)5-15-4-7(6(2)10)12-14-15/h4,6H,3,5H2,1-2H3 |
| InChIKey | RGISYXMQRCINPC-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 69.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.68 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|