C12H23NOS — CID 66217688
3-methyl-7-propyl-3,4,4a,5,6,7,8,8a-octahydro-2H-benzo[b][1,4]thiazine 1-oxide (PubChem CID 66217688) has the molecular formula C12H23NOS and a molecular weight of 229.39 g/mol. Its IUPAC name is 3-methyl-7-propyl-3,4,4a,5,6,7,8,8a-octahydro-2H-benzo[b][1,4]thiazine 1-oxide.
| Compound Name | 3-methyl-7-propyl-3,4,4a,5,6,7,8,8a-octahydro-2H-benzo[b][1,4]thiazine 1-oxide |
|---|---|
| PubChem CID | 66217688 |
| Molecular Formula | C12H23NOS |
| Molecular Weight | 229.39 g/mol |
| Exact Mass | 229.15 |
| IUPAC Name | 3-methyl-7-propyl-3,4,4a,5,6,7,8,8a-octahydro-2H-benzo[b][1,4]thiazine 1-oxide |
| SMILES | CCCC1CCC2NC(C)CS(=O)C2C1 |
| InChI | InChI=1S/C12H23NOS/c1-3-4-10-5-6-11-12(7-10)15(14)8-9(2)13-11/h9-13H,3-8H2,1-2H3 |
| InChIKey | CLPXKDLTCGGGEN-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.39 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |