C15H15ClN2 — CID 66218077
5-chloro-N-(5,6,7,8-tetrahydronaphthalen-1-yl)pyridin-2-amine (PubChem CID 66218077) has the molecular formula C15H15ClN2 and a molecular weight of 258.75 g/mol. Its IUPAC name is 5-chloro-N-(5,6,7,8-tetrahydronaphthalen-1-yl)pyridin-2-amine.
| Compound Name | 5-chloro-N-(5,6,7,8-tetrahydronaphthalen-1-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 66218077 |
| Molecular Formula | C15H15ClN2 |
| Molecular Weight | 258.75 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | 5-chloro-N-(5,6,7,8-tetrahydronaphthalen-1-yl)pyridin-2-amine |
| SMILES | Clc1ccc(Nc2cccc3c2CCCC3)nc1 |
| InChI | InChI=1S/C15H15ClN2/c16-12-8-9-15(17-10-12)18-14-7-3-5-11-4-1-2-6-13(11)14/h3,5,7-10H,1-2,4,6H2,(H,17,18) |
| InChIKey | RAIIKUWXDKZQLA-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.75 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |