C13H23N3S — CID 66218804
3-[(1-cyclohexylpyrazol-3-yl)methylsulfanyl]propan-1-amine (PubChem CID 66218804) has the molecular formula C13H23N3S and a molecular weight of 253.41 g/mol. Its IUPAC name is 3-[(1-cyclohexylpyrazol-3-yl)methylsulfanyl]propan-1-amine.
| Compound Name | 3-[(1-cyclohexylpyrazol-3-yl)methylsulfanyl]propan-1-amine |
|---|---|
| PubChem CID | 66218804 |
| Molecular Formula | C13H23N3S |
| Molecular Weight | 253.41 g/mol |
| Exact Mass | 253.16 |
| IUPAC Name | 3-[(1-cyclohexylpyrazol-3-yl)methylsulfanyl]propan-1-amine |
| SMILES | NCCCSCc1ccn(C2CCCCC2)n1 |
| InChI | InChI=1S/C13H23N3S/c14-8-4-10-17-11-12-7-9-16(15-12)13-5-2-1-3-6-13/h7,9,13H,1-6,8,10-11,14H2 |
| InChIKey | CWLFTUKRJNAFIA-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.41 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|