C16H21N3S — CID 79133685
3-[(1-cyclohexylpyrazol-3-yl)methylsulfanyl]aniline (PubChem CID 79133685) has the molecular formula C16H21N3S and a molecular weight of 287.43 g/mol. Its IUPAC name is 3-[(1-cyclohexylpyrazol-3-yl)methylsulfanyl]aniline.
| Compound Name | 3-[(1-cyclohexylpyrazol-3-yl)methylsulfanyl]aniline |
|---|---|
| PubChem CID | 79133685 |
| Molecular Formula | C16H21N3S |
| Molecular Weight | 287.43 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | 3-[(1-cyclohexylpyrazol-3-yl)methylsulfanyl]aniline |
| SMILES | Nc1cccc(SCc2ccn(C3CCCCC3)n2)c1 |
| InChI | InChI=1S/C16H21N3S/c17-13-5-4-8-16(11-13)20-12-14-9-10-19(18-14)15-6-2-1-3-7-15/h4-5,8-11,15H,1-3,6-7,12,17H2 |
| InChIKey | WEZGYFJIJDDJJP-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.43 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|