C11H16O2S — CID 66221073
1-(2,2-dimethoxyethylsulfanyl)-2-methylbenzene (PubChem CID 66221073) has the molecular formula C11H16O2S and a molecular weight of 212.31 g/mol. Its IUPAC name is 1-(2,2-dimethoxyethylsulfanyl)-2-methylbenzene.
| Compound Name | 1-(2,2-dimethoxyethylsulfanyl)-2-methylbenzene |
|---|---|
| PubChem CID | 66221073 |
| Molecular Formula | C11H16O2S |
| Molecular Weight | 212.31 g/mol |
| Exact Mass | 212.09 |
| IUPAC Name | 1-(2,2-dimethoxyethylsulfanyl)-2-methylbenzene |
| SMILES | COC(CSc1ccccc1C)OC |
| InChI | InChI=1S/C11H16O2S/c1-9-6-4-5-7-10(9)14-8-11(12-2)13-3/h4-7,11H,8H2,1-3H3 |
| InChIKey | IDBMXJRCPSSHMF-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.31 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|