C12H22ClNO2S — CID 174463399
2,2-dimethoxyethylsulfanylbenzene;ethanamine;hydrochloride (PubChem CID 174463399) has the molecular formula C12H22ClNO2S and a molecular weight of 279.83 g/mol. Its IUPAC name is 2,2-dimethoxyethylsulfanylbenzene;ethanamine;hydrochloride.
| Compound Name | 2,2-dimethoxyethylsulfanylbenzene;ethanamine;hydrochloride |
|---|---|
| PubChem CID | 174463399 |
| Molecular Formula | C12H22ClNO2S |
| Molecular Weight | 279.83 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | 2,2-dimethoxyethylsulfanylbenzene;ethanamine;hydrochloride |
| SMILES | CCN.COC(CSc1ccccc1)OC.Cl |
| InChI | InChI=1S/C10H14O2S.C2H7N.ClH/c1-11-10(12-2)8-13-9-6-4-3-5-7-9;1-2-3;/h3-7,10H,8H2,1-2H3;2-3H2,1H3;1H |
| InChIKey | ZDTOIUPYJFZSON-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.83 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|