C12H18O2S — CID 67157111
1-(2,2-dimethoxyethylsulfanyl)-4-ethylbenzene (PubChem CID 67157111) has the molecular formula C12H18O2S and a molecular weight of 226.34 g/mol. Its IUPAC name is 1-(2,2-dimethoxyethylsulfanyl)-4-ethylbenzene.
| Compound Name | 1-(2,2-dimethoxyethylsulfanyl)-4-ethylbenzene |
|---|---|
| PubChem CID | 67157111 |
| Molecular Formula | C12H18O2S |
| Molecular Weight | 226.34 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | 1-(2,2-dimethoxyethylsulfanyl)-4-ethylbenzene |
| SMILES | CCc1ccc(SCC(OC)OC)cc1 |
| InChI | InChI=1S/C12H18O2S/c1-4-10-5-7-11(8-6-10)15-9-12(13-2)14-3/h5-8,12H,4,9H2,1-3H3 |
| InChIKey | VNNQXUUDUMCHSS-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.34 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|