C25H38ClN3O — CID 6622220
3-(2-chlorophenyl)-N-[3-[4-[methyl-(2-methylcyclohexyl)amino]piperidin-1-yl]propyl]prop-2-enamide (PubChem CID 6622220) has the molecular formula C25H38ClN3O and a molecular weight of 432.05 g/mol. Its IUPAC name is 3-(2-chlorophenyl)-N-[3-[4-[methyl-(2-methylcyclohexyl)amino]piperidin-1-yl]propyl]prop-2-enamide.
| Compound Name | 3-(2-chlorophenyl)-N-[3-[4-[methyl-(2-methylcyclohexyl)amino]piperidin-1-yl]propyl]prop-2-enamide |
|---|---|
| PubChem CID | 6622220 |
| Molecular Formula | C25H38ClN3O |
| Molecular Weight | 432.05 g/mol |
| Exact Mass | 431.27 |
| IUPAC Name | 3-(2-chlorophenyl)-N-[3-[4-[methyl-(2-methylcyclohexyl)amino]piperidin-1-yl]propyl]prop-2-enamide |
| SMILES | CC1CCCCC1N(C)C1CCN(CCCNC(=O)C=Cc2ccccc2Cl)CC1 |
| InChI | InChI=1S/C25H38ClN3O/c1-20-8-3-6-11-24(20)28(2)22-14-18-29(19-15-22)17-7-16-27-25(30)13-12-21-9-4-5-10-23(21)26/h4-5,9-10,12-13,20,22,24H,3,6-8,11,14-19H2,1-2H3,(H,27,30) |
| InChIKey | FLDUIORQSZUCFH-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.05 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|