C13H13F2NO4S — CID 66223122
4-[[2-(difluoromethylsulfanyl)benzoyl]amino]oxolane-3-carboxylic acid (PubChem CID 66223122) has the molecular formula C13H13F2NO4S and a molecular weight of 317.31 g/mol. Its IUPAC name is 4-[[2-(difluoromethylsulfanyl)benzoyl]amino]oxolane-3-carboxylic acid.
| Compound Name | 4-[[2-(difluoromethylsulfanyl)benzoyl]amino]oxolane-3-carboxylic acid |
|---|---|
| PubChem CID | 66223122 |
| Molecular Formula | C13H13F2NO4S |
| Molecular Weight | 317.31 g/mol |
| Exact Mass | 317.05 |
| IUPAC Name | 4-[[2-(difluoromethylsulfanyl)benzoyl]amino]oxolane-3-carboxylic acid |
| SMILES | O=C(NC1COCC1C(=O)O)c1ccccc1SC(F)F |
| InChI | InChI=1S/C13H13F2NO4S/c14-13(15)21-10-4-2-1-3-7(10)11(17)16-9-6-20-5-8(9)12(18)19/h1-4,8-9,13H,5-6H2,(H,16,17)(H,18,19) |
| InChIKey | DARIRBGITRVKEL-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.31 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |