C12H18FNO2 — CID 66224055
N-[(2-fluorophenyl)methyl]-2,2-dimethoxy-N-methylethanamine (PubChem CID 66224055) has the molecular formula C12H18FNO2 and a molecular weight of 227.28 g/mol. Its IUPAC name is N-[(2-fluorophenyl)methyl]-2,2-dimethoxy-N-methylethanamine.
| Compound Name | N-[(2-fluorophenyl)methyl]-2,2-dimethoxy-N-methylethanamine |
|---|---|
| PubChem CID | 66224055 |
| Molecular Formula | C12H18FNO2 |
| Molecular Weight | 227.28 g/mol |
| Exact Mass | 227.13 |
| IUPAC Name | N-[(2-fluorophenyl)methyl]-2,2-dimethoxy-N-methylethanamine |
| SMILES | COC(CN(C)Cc1ccccc1F)OC |
| InChI | InChI=1S/C12H18FNO2/c1-14(9-12(15-2)16-3)8-10-6-4-5-7-11(10)13/h4-7,12H,8-9H2,1-3H3 |
| InChIKey | ATIVNRXYJPOMBL-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.28 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|