C24H22N3O4+ — CID 6622745
2-(1,3-benzodioxol-5-ylmethyl)-N-(2-methylphenyl)-3-oxo-1,4-dihydropyrido[1,2-a]pyrazin-5-ium-1-carboxamide (PubChem CID 6622745) has the molecular formula C24H22N3O4+ and a molecular weight of 416.46 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-ylmethyl)-N-(2-methylphenyl)-3-oxo-1,4-dihydropyrido[1,2-a]pyrazin-5-ium-1-carboxamide.
| Compound Name | 2-(1,3-benzodioxol-5-ylmethyl)-N-(2-methylphenyl)-3-oxo-1,4-dihydropyrido[1,2-a]pyrazin-5-ium-1-carboxamide |
|---|---|
| PubChem CID | 6622745 |
| Molecular Formula | C24H22N3O4+ |
| Molecular Weight | 416.46 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | 2-(1,3-benzodioxol-5-ylmethyl)-N-(2-methylphenyl)-3-oxo-1,4-dihydropyrido[1,2-a]pyrazin-5-ium-1-carboxamide |
| SMILES | Cc1ccccc1NC(=O)C1c2cccc[n+]2CC(=O)N1Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C24H21N3O4/c1-16-6-2-3-7-18(16)25-24(29)23-19-8-4-5-11-26(19)14-22(28)27(23)13-17-9-10-20-21(12-17)31-15-30-20/h2-12,23H,13-15H2,1H3/p+1 |
| InChIKey | KMUZVDRRMDLNOQ-UHFFFAOYSA-O |
| XLogP | 2.73 |
| TPSA | 71.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.46 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|