C25H26N3O2+ — CID 46257219
2-(2-ethyl-6-methylphenyl)-N-(2-methylphenyl)-3-oxo-1,4-dihydropyrido[1,2-a]pyrazin-5-ium-1-carboxamide (PubChem CID 46257219) has the molecular formula C25H26N3O2+ and a molecular weight of 400.50 g/mol. Its IUPAC name is 2-(2-ethyl-6-methylphenyl)-N-(2-methylphenyl)-3-oxo-1,4-dihydropyrido[1,2-a]pyrazin-5-ium-1-carboxamide.
| Compound Name | 2-(2-ethyl-6-methylphenyl)-N-(2-methylphenyl)-3-oxo-1,4-dihydropyrido[1,2-a]pyrazin-5-ium-1-carboxamide |
|---|---|
| PubChem CID | 46257219 |
| Molecular Formula | C25H26N3O2+ |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | 2-(2-ethyl-6-methylphenyl)-N-(2-methylphenyl)-3-oxo-1,4-dihydropyrido[1,2-a]pyrazin-5-ium-1-carboxamide |
| SMILES | CCc1cccc(C)c1N1C(=O)C[n+]2ccccc2C1C(=O)Nc1ccccc1C |
| InChI | InChI=1S/C25H25N3O2/c1-4-19-12-9-11-18(3)23(19)28-22(29)16-27-15-8-7-14-21(27)24(28)25(30)26-20-13-6-5-10-17(20)2/h5-15,24H,4,16H2,1-3H3/p+1 |
| InChIKey | HUAPWIYCGBBIBB-UHFFFAOYSA-O |
| XLogP | 3.88 |
| TPSA | 53.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|