C22H20N3O2+ — CID 46257136
N-(2-methylphenyl)-3-oxo-2-phenyl-1,4-dihydropyrido[1,2-a]pyrazin-5-ium-1-carboxamide (PubChem CID 46257136) has the molecular formula C22H20N3O2+ and a molecular weight of 358.42 g/mol. Its IUPAC name is N-(2-methylphenyl)-3-oxo-2-phenyl-1,4-dihydropyrido[1,2-a]pyrazin-5-ium-1-carboxamide.
| Compound Name | N-(2-methylphenyl)-3-oxo-2-phenyl-1,4-dihydropyrido[1,2-a]pyrazin-5-ium-1-carboxamide |
|---|---|
| PubChem CID | 46257136 |
| Molecular Formula | C22H20N3O2+ |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | N-(2-methylphenyl)-3-oxo-2-phenyl-1,4-dihydropyrido[1,2-a]pyrazin-5-ium-1-carboxamide |
| SMILES | Cc1ccccc1NC(=O)C1c2cccc[n+]2CC(=O)N1c1ccccc1 |
| InChI | InChI=1S/C22H19N3O2/c1-16-9-5-6-12-18(16)23-22(27)21-19-13-7-8-14-24(19)15-20(26)25(21)17-10-3-2-4-11-17/h2-14,21H,15H2,1H3/p+1 |
| InChIKey | UHSPUKNAWQSVSC-UHFFFAOYSA-O |
| XLogP | 3.01 |
| TPSA | 53.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|