C22H19FIN3O3 — CID 146051748
2-(4-fluorophenyl)-N-(4-methoxyphenyl)-3-oxo-1,4-dihydropyrido[1,2-a]pyrazin-5-ium-1-carboxamide iodide (PubChem CID 146051748) has the molecular formula C22H19FIN3O3 and a molecular weight of 519.31 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-N-(4-methoxyphenyl)-3-oxo-1,4-dihydropyrido[1,2-a]pyrazin-5-ium-1-carboxamide iodide.
| Compound Name | 2-(4-fluorophenyl)-N-(4-methoxyphenyl)-3-oxo-1,4-dihydropyrido[1,2-a]pyrazin-5-ium-1-carboxamide iodide |
|---|---|
| PubChem CID | 146051748 |
| Molecular Formula | C22H19FIN3O3 |
| Molecular Weight | 519.31 g/mol |
| Exact Mass | 519.05 |
| IUPAC Name | 2-(4-fluorophenyl)-N-(4-methoxyphenyl)-3-oxo-1,4-dihydropyrido[1,2-a]pyrazin-5-ium-1-carboxamide iodide |
| SMILES | COc1ccc(NC(=O)C2c3cccc[n+]3CC(=O)N2c2ccc(F)cc2)cc1.[I-] |
| InChI | InChI=1S/C22H18FN3O3.HI/c1-29-18-11-7-16(8-12-18)24-22(28)21-19-4-2-3-13-25(19)14-20(27)26(21)17-9-5-15(23)6-10-17;/h2-13,21H,14H2,1H3;1H |
| InChIKey | VTTXDERHWIHRFO-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 62.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.31 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|