C23H22N3O3+ — CID 46257220
N-(4-methoxyphenyl)-2-(4-methylphenyl)-3-oxo-1,4-dihydropyrido[1,2-a]pyrazin-5-ium-1-carboxamide (PubChem CID 46257220) has the molecular formula C23H22N3O3+ and a molecular weight of 388.45 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-2-(4-methylphenyl)-3-oxo-1,4-dihydropyrido[1,2-a]pyrazin-5-ium-1-carboxamide.
| Compound Name | N-(4-methoxyphenyl)-2-(4-methylphenyl)-3-oxo-1,4-dihydropyrido[1,2-a]pyrazin-5-ium-1-carboxamide |
|---|---|
| PubChem CID | 46257220 |
| Molecular Formula | C23H22N3O3+ |
| Molecular Weight | 388.45 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | N-(4-methoxyphenyl)-2-(4-methylphenyl)-3-oxo-1,4-dihydropyrido[1,2-a]pyrazin-5-ium-1-carboxamide |
| SMILES | COc1ccc(NC(=O)C2c3cccc[n+]3CC(=O)N2c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C23H21N3O3/c1-16-6-10-18(11-7-16)26-21(27)15-25-14-4-3-5-20(25)22(26)23(28)24-17-8-12-19(29-2)13-9-17/h3-14,22H,15H2,1-2H3/p+1 |
| InChIKey | UEPFFPOUPSOKIG-UHFFFAOYSA-O |
| XLogP | 3.02 |
| TPSA | 62.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.45 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|