C24H24N3O3+ — CID 46246385
N-(2,6-dimethylphenyl)-2-(4-methoxyphenyl)-3-oxo-1,4-dihydropyrido[1,2-a]pyrazin-5-ium-1-carboxamide (PubChem CID 46246385) has the molecular formula C24H24N3O3+ and a molecular weight of 402.47 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-2-(4-methoxyphenyl)-3-oxo-1,4-dihydropyrido[1,2-a]pyrazin-5-ium-1-carboxamide.
| Compound Name | N-(2,6-dimethylphenyl)-2-(4-methoxyphenyl)-3-oxo-1,4-dihydropyrido[1,2-a]pyrazin-5-ium-1-carboxamide |
|---|---|
| PubChem CID | 46246385 |
| Molecular Formula | C24H24N3O3+ |
| Molecular Weight | 402.47 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | N-(2,6-dimethylphenyl)-2-(4-methoxyphenyl)-3-oxo-1,4-dihydropyrido[1,2-a]pyrazin-5-ium-1-carboxamide |
| SMILES | COc1ccc(N2C(=O)C[n+]3ccccc3C2C(=O)Nc2c(C)cccc2C)cc1 |
| InChI | InChI=1S/C24H23N3O3/c1-16-7-6-8-17(2)22(16)25-24(29)23-20-9-4-5-14-26(20)15-21(28)27(23)18-10-12-19(30-3)13-11-18/h4-14,23H,15H2,1-3H3/p+1 |
| InChIKey | RTGYLFBYWIQRKO-UHFFFAOYSA-O |
| XLogP | 3.33 |
| TPSA | 62.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.47 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|