C23H21FIN3O2 — CID 146051749
N-(2,6-dimethylphenyl)-2-(4-fluorophenyl)-3-oxo-1,4-dihydropyrido[1,2-a]pyrazin-5-ium-1-carboxamide iodide (PubChem CID 146051749) has the molecular formula C23H21FIN3O2 and a molecular weight of 517.34 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-2-(4-fluorophenyl)-3-oxo-1,4-dihydropyrido[1,2-a]pyrazin-5-ium-1-carboxamide iodide.
| Compound Name | N-(2,6-dimethylphenyl)-2-(4-fluorophenyl)-3-oxo-1,4-dihydropyrido[1,2-a]pyrazin-5-ium-1-carboxamide iodide |
|---|---|
| PubChem CID | 146051749 |
| Molecular Formula | C23H21FIN3O2 |
| Molecular Weight | 517.34 g/mol |
| Exact Mass | 517.07 |
| IUPAC Name | N-(2,6-dimethylphenyl)-2-(4-fluorophenyl)-3-oxo-1,4-dihydropyrido[1,2-a]pyrazin-5-ium-1-carboxamide iodide |
| SMILES | Cc1cccc(C)c1NC(=O)C1c2cccc[n+]2CC(=O)N1c1ccc(F)cc1.[I-] |
| InChI | InChI=1S/C23H20FN3O2.HI/c1-15-6-5-7-16(2)21(15)25-23(29)22-19-8-3-4-13-26(19)14-20(28)27(22)18-11-9-17(24)10-12-18;/h3-13,22H,14H2,1-2H3;1H |
| InChIKey | AGFOQWYWJWLDNQ-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 53.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.34 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|