C23H21ClN3O4+ — CID 92666347
(1S)-N-(4-chlorophenyl)-2-(2,4-dimethoxyphenyl)-3-oxo-1,4-dihydropyrido[1,2-a]pyrazin-5-ium-1-carboxamide (PubChem CID 92666347) has the molecular formula C23H21ClN3O4+ and a molecular weight of 438.89 g/mol. Its IUPAC name is (1S)-N-(4-chlorophenyl)-2-(2,4-dimethoxyphenyl)-3-oxo-1,4-dihydropyrido[1,2-a]pyrazin-5-ium-1-carboxamide.
| Compound Name | (1S)-N-(4-chlorophenyl)-2-(2,4-dimethoxyphenyl)-3-oxo-1,4-dihydropyrido[1,2-a]pyrazin-5-ium-1-carboxamide |
|---|---|
| PubChem CID | 92666347 |
| Molecular Formula | C23H21ClN3O4+ |
| Molecular Weight | 438.89 g/mol |
| Exact Mass | 438.12 |
| IUPAC Name | (1S)-N-(4-chlorophenyl)-2-(2,4-dimethoxyphenyl)-3-oxo-1,4-dihydropyrido[1,2-a]pyrazin-5-ium-1-carboxamide |
| SMILES | COc1ccc(N2C(=O)C[n+]3ccccc3[C@H]2C(=O)Nc2ccc(Cl)cc2)c(OC)c1 |
| InChI | InChI=1S/C23H20ClN3O4/c1-30-17-10-11-18(20(13-17)31-2)27-21(28)14-26-12-4-3-5-19(26)22(27)23(29)25-16-8-6-15(24)7-9-16/h3-13,22H,14H2,1-2H3/p+1/t22-/m0/s1 |
| InChIKey | UOYRTZLQSOBUQN-QFIPXVFZSA-O |
| XLogP | 3.37 |
| TPSA | 71.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.89 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|