C19H22FN7S — CID 6622899
4-[3-(4-fluorophenyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]-N-propan-2-ylpiperazine-1-carbothioamide (PubChem CID 6622899) has the molecular formula C19H22FN7S and a molecular weight of 399.50 g/mol. Its IUPAC name is 4-[3-(4-fluorophenyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]-N-propan-2-ylpiperazine-1-carbothioamide.
| Compound Name | 4-[3-(4-fluorophenyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]-N-propan-2-ylpiperazine-1-carbothioamide |
|---|---|
| PubChem CID | 6622899 |
| Molecular Formula | C19H22FN7S |
| Molecular Weight | 399.50 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | 4-[3-(4-fluorophenyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]-N-propan-2-ylpiperazine-1-carbothioamide |
| SMILES | CC(C)NC(=S)N1CCN(c2ccc3nnc(-c4ccc(F)cc4)n3n2)CC1 |
| InChI | InChI=1S/C19H22FN7S/c1-13(2)21-19(28)26-11-9-25(10-12-26)17-8-7-16-22-23-18(27(16)24-17)14-3-5-15(20)6-4-14/h3-8,13H,9-12H2,1-2H3,(H,21,28) |
| InChIKey | JPGOQBBFVMNNMQ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 61.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.50 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|