C24H24FN7OS — CID 46259771
N-(4-ethoxyphenyl)-4-[3-(4-fluorophenyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]piperazine-1-carbothioamide (PubChem CID 46259771) has the molecular formula C24H24FN7OS and a molecular weight of 477.57 g/mol. Its IUPAC name is N-(4-ethoxyphenyl)-4-[3-(4-fluorophenyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]piperazine-1-carbothioamide.
| Compound Name | N-(4-ethoxyphenyl)-4-[3-(4-fluorophenyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 46259771 |
| Molecular Formula | C24H24FN7OS |
| Molecular Weight | 477.57 g/mol |
| Exact Mass | 477.17 |
| IUPAC Name | N-(4-ethoxyphenyl)-4-[3-(4-fluorophenyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]piperazine-1-carbothioamide |
| SMILES | CCOc1ccc(NC(=S)N2CCN(c3ccc4nnc(-c5ccc(F)cc5)n4n3)CC2)cc1 |
| InChI | InChI=1S/C24H24FN7OS/c1-2-33-20-9-7-19(8-10-20)26-24(34)31-15-13-30(14-16-31)22-12-11-21-27-28-23(32(21)29-22)17-3-5-18(25)6-4-17/h3-12H,2,13-16H2,1H3,(H,26,34) |
| InChIKey | GMDCIGFRMMTVII-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 70.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.57 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|