C14H21NO4 — CID 66235736
4-[[2-(cyclohexen-1-yl)acetyl]-methylamino]oxolane-3-carboxylic acid (PubChem CID 66235736) has the molecular formula C14H21NO4 and a molecular weight of 267.32 g/mol. Its IUPAC name is 4-[[2-(cyclohexen-1-yl)acetyl]-methylamino]oxolane-3-carboxylic acid.
| Compound Name | 4-[[2-(cyclohexen-1-yl)acetyl]-methylamino]oxolane-3-carboxylic acid |
|---|---|
| PubChem CID | 66235736 |
| Molecular Formula | C14H21NO4 |
| Molecular Weight | 267.32 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | 4-[[2-(cyclohexen-1-yl)acetyl]-methylamino]oxolane-3-carboxylic acid |
| SMILES | CN(C(=O)CC1=CCCCC1)C1COCC1C(=O)O |
| InChI | InChI=1S/C14H21NO4/c1-15(12-9-19-8-11(12)14(17)18)13(16)7-10-5-3-2-4-6-10/h5,11-12H,2-4,6-9H2,1H3,(H,17,18) |
| InChIKey | ZSMPSLRDTRALOW-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.32 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|