C17H18N4O — CID 6623759
2-(3-methylpiperidin-1-yl)pyridazino[6,1-b]quinazolin-10-one (PubChem CID 6623759) has the molecular formula C17H18N4O and a molecular weight of 294.36 g/mol. Its IUPAC name is 2-(3-methylpiperidin-1-yl)pyridazino[6,1-b]quinazolin-10-one.
| Compound Name | 2-(3-methylpiperidin-1-yl)pyridazino[6,1-b]quinazolin-10-one |
|---|---|
| PubChem CID | 6623759 |
| Molecular Formula | C17H18N4O |
| Molecular Weight | 294.36 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | 2-(3-methylpiperidin-1-yl)pyridazino[6,1-b]quinazolin-10-one |
| SMILES | CC1CCCN(c2ccc3nc4ccccc4c(=O)n3n2)C1 |
| InChI | InChI=1S/C17H18N4O/c1-12-5-4-10-20(11-12)16-9-8-15-18-14-7-3-2-6-13(14)17(22)21(15)19-16/h2-3,6-9,12H,4-5,10-11H2,1H3 |
| InChIKey | GPVJMZRQOFDNNN-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 50.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.36 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|