C16H14N4O3S — CID 6623947
N-(furan-2-ylmethyl)-2-[(4-methyl-5-oxa-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7,9,11-pentaen-9-yl)sulfanyl]acetamide (PubChem CID 6623947) has the molecular formula C16H14N4O3S and a molecular weight of 342.38 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-2-[(4-methyl-5-oxa-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7,9,11-pentaen-9-yl)sulfanyl]acetamide.
| Compound Name | N-(furan-2-ylmethyl)-2-[(4-methyl-5-oxa-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7,9,11-pentaen-9-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 6623947 |
| Molecular Formula | C16H14N4O3S |
| Molecular Weight | 342.38 g/mol |
| Exact Mass | 342.08 |
| IUPAC Name | N-(furan-2-ylmethyl)-2-[(4-methyl-5-oxa-1,10,11-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7,9,11-pentaen-9-yl)sulfanyl]acetamide |
| SMILES | Cc1cc2c(cc3c(SCC(=O)NCc4ccco4)nncn32)o1 |
| InChI | InChI=1S/C16H14N4O3S/c1-10-5-12-14(23-10)6-13-16(19-18-9-20(12)13)24-8-15(21)17-7-11-3-2-4-22-11/h2-6,9H,7-8H2,1H3,(H,17,21) |
| InChIKey | NWQLVWHWJOHWMD-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 85.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.38 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |