C10H11FN2O5S — CID 66240680
4-[(5-fluoro-3-pyridinyl)sulfonylamino]oxolane-3-carboxylic acid (PubChem CID 66240680) has the molecular formula C10H11FN2O5S and a molecular weight of 290.27 g/mol. Its IUPAC name is 4-[(5-fluoro-3-pyridinyl)sulfonylamino]oxolane-3-carboxylic acid.
| Compound Name | 4-[(5-fluoro-3-pyridinyl)sulfonylamino]oxolane-3-carboxylic acid |
|---|---|
| PubChem CID | 66240680 |
| Molecular Formula | C10H11FN2O5S |
| Molecular Weight | 290.27 g/mol |
| Exact Mass | 290.04 |
| IUPAC Name | 4-[(5-fluoro-3-pyridinyl)sulfonylamino]oxolane-3-carboxylic acid |
| SMILES | O=C(O)C1COCC1NS(=O)(=O)c1cncc(F)c1 |
| InChI | InChI=1S/C10H11FN2O5S/c11-6-1-7(3-12-2-6)19(16,17)13-9-5-18-4-8(9)10(14)15/h1-3,8-9,13H,4-5H2,(H,14,15) |
| InChIKey | SHALWWFALYGGBF-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 105.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.27 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |