About 4-[(3,5-dioxopiperazine-1-carbonyl)amino]oxolane-3-carboxylic acid
4-[(3,5-dioxopiperazine-1-carbonyl)amino]oxolane-3-carboxylic acid (PubChem CID 66241377) has the molecular formula C10H13N3O6
and a molecular weight of 271.23 g/mol. Its IUPAC name is 4-[(3,5-dioxopiperazine-1-carbonyl)amino]oxolane-3-carboxylic acid.
Molecular Properties
| Compound Name | 4-[(3,5-dioxopiperazine-1-carbonyl)amino]oxolane-3-carboxylic acid |
| PubChem CID | 66241377 |
| Molecular Formula | C10H13N3O6 |
| Molecular Weight | 271.23 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | 4-[(3,5-dioxopiperazine-1-carbonyl)amino]oxolane-3-carboxylic acid |
| SMILES | O=C1CN(C(=O)NC2COCC2C(=O)O)CC(=O)N1 |
| InChI | InChI=1S/C10H13N3O6/c14-7-1-13(2-8(15)12-7)10(18)11-6-4-19-3-5(6)9(16)17/h5-6H,1-4H2,(H,11,18)(H,16,17)(H,12,14,15) |
| InChIKey | IKQUFIJCXHPAEB-UHFFFAOYSA-N |
| XLogP | -2.25 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.23 |
| LogP ≤ 5 | -2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 4-[(3,5-dioxopiperazine-1-carbonyl)amino]oxolane-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(3,5-dioxopiperazine-1-carbonyl)amino]oxolane-3-carboxylic acid?
The IUPAC name of 4-[(3,5-dioxopiperazine-1-carbonyl)amino]oxolane-3-carboxylic acid (CID 66241377) is 4-[(3,5-dioxopiperazine-1-carbonyl)amino]oxolane-3-carboxylic acid.
What is the SMILES notation for 4-[(3,5-dioxopiperazine-1-carbonyl)amino]oxolane-3-carboxylic acid?
The canonical SMILES for 4-[(3,5-dioxopiperazine-1-carbonyl)amino]oxolane-3-carboxylic acid is O=C1CN(C(=O)NC2COCC2C(=O)O)CC(=O)N1.
What is the InChIKey of 4-[(3,5-dioxopiperazine-1-carbonyl)amino]oxolane-3-carboxylic acid?
The InChIKey is IKQUFIJCXHPAEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3O6/c14-7-1-13(2-8(15)12-7)10(18)11-6-4-19-3-5(6)9(16)17/h5-6H,1-4H2,(H,11,18)(H,16,17)(H,12,14,15).
What are the key properties of 4-[(3,5-dioxopiperazine-1-carbonyl)amino]oxolane-3-carboxylic acid?
4-[(3,5-dioxopiperazine-1-carbonyl)amino]oxolane-3-carboxylic acid has a molecular weight of 271.23 g/mol, XLogP of -2.25, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3,5-dioxopiperazine-1-carbonyl)amino]oxolane-3-carboxylic acid is sourced from PubChem (CID 66241377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).