C10H13N3O6 — CID 66241377
4-[(3,5-dioxopiperazine-1-carbonyl)amino]oxolane-3-carboxylic acid (PubChem CID 66241377) has the molecular formula C10H13N3O6 and a molecular weight of 271.23 g/mol. Its IUPAC name is 4-[(3,5-dioxopiperazine-1-carbonyl)amino]oxolane-3-carboxylic acid.
| Compound Name | 4-[(3,5-dioxopiperazine-1-carbonyl)amino]oxolane-3-carboxylic acid |
|---|---|
| PubChem CID | 66241377 |
| Molecular Formula | C10H13N3O6 |
| Molecular Weight | 271.23 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | 4-[(3,5-dioxopiperazine-1-carbonyl)amino]oxolane-3-carboxylic acid |
| SMILES | O=C1CN(C(=O)NC2COCC2C(=O)O)CC(=O)N1 |
| InChI | InChI=1S/C10H13N3O6/c14-7-1-13(2-8(15)12-7)10(18)11-6-4-19-3-5(6)9(16)17/h5-6H,1-4H2,(H,11,18)(H,16,17)(H,12,14,15) |
| InChIKey | IKQUFIJCXHPAEB-UHFFFAOYSA-N |
| XLogP | -2.25 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.23 |
| LogP ≤ 5 | -2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|