C13H22N2O4 — CID 114114326
4-[(1-propan-2-ylcyclopropyl)methylcarbamoylamino]oxolane-3-carboxylic acid (PubChem CID 114114326) has the molecular formula C13H22N2O4 and a molecular weight of 270.33 g/mol. Its IUPAC name is 4-[(1-propan-2-ylcyclopropyl)methylcarbamoylamino]oxolane-3-carboxylic acid.
| Compound Name | 4-[(1-propan-2-ylcyclopropyl)methylcarbamoylamino]oxolane-3-carboxylic acid |
|---|---|
| PubChem CID | 114114326 |
| Molecular Formula | C13H22N2O4 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | 4-[(1-propan-2-ylcyclopropyl)methylcarbamoylamino]oxolane-3-carboxylic acid |
| SMILES | CC(C)C1(CNC(=O)NC2COCC2C(=O)O)CC1 |
| InChI | InChI=1S/C13H22N2O4/c1-8(2)13(3-4-13)7-14-12(18)15-10-6-19-5-9(10)11(16)17/h8-10H,3-7H2,1-2H3,(H,16,17)(H2,14,15,18) |
| InChIKey | PKANZOYIMPGHLQ-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |