C9H14N2O6 — CID 66238536
4-[(2-methoxy-2-oxoethyl)carbamoylamino]oxolane-3-carboxylic acid (PubChem CID 66238536) has the molecular formula C9H14N2O6 and a molecular weight of 246.22 g/mol. Its IUPAC name is 4-[(2-methoxy-2-oxoethyl)carbamoylamino]oxolane-3-carboxylic acid.
| Compound Name | 4-[(2-methoxy-2-oxoethyl)carbamoylamino]oxolane-3-carboxylic acid |
|---|---|
| PubChem CID | 66238536 |
| Molecular Formula | C9H14N2O6 |
| Molecular Weight | 246.22 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | 4-[(2-methoxy-2-oxoethyl)carbamoylamino]oxolane-3-carboxylic acid |
| SMILES | COC(=O)CNC(=O)NC1COCC1C(=O)O |
| InChI | InChI=1S/C9H14N2O6/c1-16-7(12)2-10-9(15)11-6-4-17-3-5(6)8(13)14/h5-6H,2-4H2,1H3,(H,13,14)(H2,10,11,15) |
| InChIKey | KISVCAMHHSFHRP-UHFFFAOYSA-N |
| XLogP | -1.44 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.22 |
| LogP ≤ 5 | -1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |